C16H22F13NOS — CID 101424708
N-butyl-N-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfinyl)ethyl]butan-1-amine (PubChem CID 101424708) has the molecular formula C16H22F13NOS and a molecular weight of 523.40 g/mol. Its IUPAC name is N-butyl-N-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfinyl)ethyl]butan-1-amine.
| Compound Name | N-butyl-N-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfinyl)ethyl]butan-1-amine |
|---|---|
| PubChem CID | 101424708 |
| Molecular Formula | C16H22F13NOS |
| Molecular Weight | 523.40 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | N-butyl-N-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfinyl)ethyl]butan-1-amine |
| SMILES | CCCCN(CCCC)CCS(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H22F13NOS/c1-3-5-7-30(8-6-4-2)9-10-32(31)16(28,29)14(23,24)12(19,20)11(17,18)13(21,22)15(25,26)27/h3-10H2,1-2H3 |
| InChIKey | XZZORWCCYOXLFK-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.40 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|