C28H30N6O4 — CID 10142474
20-ethyl-17,23-dioxa-4,12,14,20,26,28-hexazahexacyclo[24.6.1.17,14.02,6.08,13.027,32]tetratriaconta-1(33),2(6),7(34),8(13),9,11,27(32),28,30-nonaene-3,5-dione (PubChem CID 10142474) has the molecular formula C28H30N6O4 and a molecular weight of 514.59 g/mol. Its IUPAC name is 20-ethyl-17,23-dioxa-4,12,14,20,26,28-hexazahexacyclo[24.6.1.17,14.02,6.08,13.027,32]tetratriaconta-1(33),2(6),7(34),8(13),9,11,27(32),28,30-nonaene-3,5-dione.
| Compound Name | 20-ethyl-17,23-dioxa-4,12,14,20,26,28-hexazahexacyclo[24.6.1.17,14.02,6.08,13.027,32]tetratriaconta-1(33),2(6),7(34),8(13),9,11,27(32),28,30-nonaene-3,5-dione |
|---|---|
| PubChem CID | 10142474 |
| Molecular Formula | C28H30N6O4 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 20-ethyl-17,23-dioxa-4,12,14,20,26,28-hexazahexacyclo[24.6.1.17,14.02,6.08,13.027,32]tetratriaconta-1(33),2(6),7(34),8(13),9,11,27(32),28,30-nonaene-3,5-dione |
| SMILES | CCN1CCOCCn2cc(c3cccnc32)C2=C(C(=O)NC2=O)c2cn(c3ncccc23)CCOCC1 |
| InChI | InChI=1S/C28H30N6O4/c1-2-32-9-13-37-15-11-33-17-21(19-5-3-7-29-25(19)33)23-24(28(36)31-27(23)35)22-18-34(12-16-38-14-10-32)26-20(22)6-4-8-30-26/h3-8,17-18H,2,9-16H2,1H3,(H,31,35,36) |
| InChIKey | MRGODZOKOTXCOP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|