C57H68N3O9P3 — CID 101424888
N-[3-[2,2-bis[3-[(2-diphenylphosphorylacetyl)amino]propoxymethyl]butoxy]propyl]-2-diphenylphosphorylacetamide (PubChem CID 101424888) has the molecular formula C57H68N3O9P3 and a molecular weight of 1032.11 g/mol. Its IUPAC name is N-[3-[2,2-bis[3-[(2-diphenylphosphorylacetyl)amino]propoxymethyl]butoxy]propyl]-2-diphenylphosphorylacetamide.
| Compound Name | N-[3-[2,2-bis[3-[(2-diphenylphosphorylacetyl)amino]propoxymethyl]butoxy]propyl]-2-diphenylphosphorylacetamide |
|---|---|
| PubChem CID | 101424888 |
| Molecular Formula | C57H68N3O9P3 |
| Molecular Weight | 1032.11 g/mol |
| Exact Mass | 1031.42 |
| IUPAC Name | N-[3-[2,2-bis[3-[(2-diphenylphosphorylacetyl)amino]propoxymethyl]butoxy]propyl]-2-diphenylphosphorylacetamide |
| SMILES | CCC(COCCCNC(=O)CP(=O)(c1ccccc1)c1ccccc1)(COCCCNC(=O)CP(=O)(c1ccccc1)c1ccccc1)COCCCNC(=O)CP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C57H68N3O9P3/c1-2-57(45-67-39-21-36-58-54(61)42-70(64,48-24-9-3-10-25-48)49-26-11-4-12-27-49,46-68-40-22-37-59-55(62)43-71(65,50-28-13-5-14-29-50)51-30-15-6-16-31-51)47-69-41-23-38-60-56(63)44-72(66,52-32-17-7-18-33-52)53-34-19-8-20-35-53/h3-20,24-35H,2,21-23,36-47H2,1H3,(H,58,61)(H,59,62)(H,60,63) |
| InChIKey | KWIMPSXFHFHUJC-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 166.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1032.11 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|