About 1-(3,4-dihydro-2H-pyrrol-5-yl)-2,5-diphenylpyrrolidine
1-(3,4-dihydro-2H-pyrrol-5-yl)-2,5-diphenylpyrrolidine (PubChem CID 101425247) has the molecular formula C20H22N2
and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyrrol-5-yl)-2,5-diphenylpyrrolidine.
Molecular Properties
| Compound Name | 1-(3,4-dihydro-2H-pyrrol-5-yl)-2,5-diphenylpyrrolidine |
| PubChem CID | 101425247 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyrrol-5-yl)-2,5-diphenylpyrrolidine |
| SMILES | c1ccc(C2CCC(c3ccccc3)N2C2=NCCC2)cc1 |
| InChI | InChI=1S/C20H22N2/c1-3-8-16(9-4-1)18-13-14-19(17-10-5-2-6-11-17)22(18)20-12-7-15-21-20/h1-6,8-11,18-19H,7,12-15H2 |
| InChIKey | HLIANWUEFPCIBD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3,4-dihydro-2H-pyrrol-5-yl)-2,5-diphenylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dihydro-2H-pyrrol-5-yl)-2,5-diphenylpyrrolidine?
The IUPAC name of 1-(3,4-dihydro-2H-pyrrol-5-yl)-2,5-diphenylpyrrolidine (CID 101425247) is 1-(3,4-dihydro-2H-pyrrol-5-yl)-2,5-diphenylpyrrolidine.
What is the SMILES notation for 1-(3,4-dihydro-2H-pyrrol-5-yl)-2,5-diphenylpyrrolidine?
The canonical SMILES for 1-(3,4-dihydro-2H-pyrrol-5-yl)-2,5-diphenylpyrrolidine is c1ccc(C2CCC(c3ccccc3)N2C2=NCCC2)cc1.
What is the InChIKey of 1-(3,4-dihydro-2H-pyrrol-5-yl)-2,5-diphenylpyrrolidine?
The InChIKey is HLIANWUEFPCIBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2/c1-3-8-16(9-4-1)18-13-14-19(17-10-5-2-6-11-17)22(18)20-12-7-15-21-20/h1-6,8-11,18-19H,7,12-15H2.
What are the key properties of 1-(3,4-dihydro-2H-pyrrol-5-yl)-2,5-diphenylpyrrolidine?
1-(3,4-dihydro-2H-pyrrol-5-yl)-2,5-diphenylpyrrolidine has a molecular weight of 290.41 g/mol, XLogP of 4.76, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dihydro-2H-pyrrol-5-yl)-2,5-diphenylpyrrolidine is sourced from PubChem (CID 101425247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).