C21H37NaO11SSi — CID 101425426
sodium [(1S,3R,8S,10R,12S,14S,15S,17R,18R)-6,6-ditert-butyl-14,18-dihydroxy-17-methyl-2,5,7,11,16-pentaoxa-6-silatetracyclo[8.8.0.03,8.012,17]octadecan-15-yl] sulfate (PubChem CID 101425426) has the molecular formula C21H37NaO11SSi and a molecular weight of 548.66 g/mol. Its IUPAC name is sodium [(1S,3R,8S,10R,12S,14S,15S,17R,18R)-6,6-ditert-butyl-14,18-dihydroxy-17-methyl-2,5,7,11,16-pentaoxa-6-silatetracyclo[8.8.0.03,8.012,17]octadecan-15-yl] sulfate.
| Compound Name | sodium [(1S,3R,8S,10R,12S,14S,15S,17R,18R)-6,6-ditert-butyl-14,18-dihydroxy-17-methyl-2,5,7,11,16-pentaoxa-6-silatetracyclo[8.8.0.03,8.012,17]octadecan-15-yl] sulfate |
|---|---|
| PubChem CID | 101425426 |
| Molecular Formula | C21H37NaO11SSi |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | sodium [(1S,3R,8S,10R,12S,14S,15S,17R,18R)-6,6-ditert-butyl-14,18-dihydroxy-17-methyl-2,5,7,11,16-pentaoxa-6-silatetracyclo[8.8.0.03,8.012,17]octadecan-15-yl] sulfate |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)OC[C@H]2O[C@H]3[C@@H](O)[C@@]4(C)O[C@@H](OS(=O)(=O)[O-])[C@@H](O)C[C@@H]4O[C@@H]3C[C@@H]2O1.[Na+] |
| InChI | InChI=1S/C21H38O11SSi.Na/c1-19(2,3)34(20(4,5)6)27-10-14-12(32-34)9-13-16(29-14)17(23)21(7)15(28-13)8-11(22)18(30-21)31-33(24,25)26;/h11-18,22-23H,8-10H2,1-7H3,(H,24,25,26);/q;+1/p-1/t11-,12-,13+,14+,15-,16+,17+,18-,21-;/m0./s1 |
| InChIKey | YDJHNPPRJOYXPH-YTWNYGACSA-M |
| XLogP | -1.92 |
| TPSA | 153.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|