C8H8N4O4 — CID 101425559
3,5,9,11-tetrazatricyclo[6.4.0.02,7]dodecane-4,6,10,12-tetrone (PubChem CID 101425559) has the molecular formula C8H8N4O4 and a molecular weight of 224.18 g/mol. Its IUPAC name is 3,5,9,11-tetrazatricyclo[6.4.0.02,7]dodecane-4,6,10,12-tetrone.
| Compound Name | 3,5,9,11-tetrazatricyclo[6.4.0.02,7]dodecane-4,6,10,12-tetrone |
|---|---|
| PubChem CID | 101425559 |
| Molecular Formula | C8H8N4O4 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 3,5,9,11-tetrazatricyclo[6.4.0.02,7]dodecane-4,6,10,12-tetrone |
| SMILES | O=C1NC(=O)C2C(N1)C1C(=O)NC(=O)NC21 |
| InChI | InChI=1S/C8H8N4O4/c13-5-1-3(9-7(15)11-5)2-4(1)10-8(16)12-6(2)14/h1-4H,(H2,9,11,13,15)(H2,10,12,14,16) |
| InChIKey | LRFJERMEBKCIKN-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |