About (2-chlorophenyl)methyl N,N-diethylcarbamodithioate
(2-chlorophenyl)methyl N,N-diethylcarbamodithioate (PubChem CID 101425594) has the molecular formula C12H16ClNS2
and a molecular weight of 273.85 g/mol. Its IUPAC name is (2-chlorophenyl)methyl N,N-diethylcarbamodithioate.
Molecular Properties
| Compound Name | (2-chlorophenyl)methyl N,N-diethylcarbamodithioate |
| PubChem CID | 101425594 |
| Molecular Formula | C12H16ClNS2 |
| Molecular Weight | 273.85 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | (2-chlorophenyl)methyl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCc1ccccc1Cl |
| InChI | InChI=1S/C12H16ClNS2/c1-3-14(4-2)12(15)16-9-10-7-5-6-8-11(10)13/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | UNBCSRFOAJMMAB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.85 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2-chlorophenyl)methyl N,N-diethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl)methyl N,N-diethylcarbamodithioate?
The IUPAC name of (2-chlorophenyl)methyl N,N-diethylcarbamodithioate (CID 101425594) is (2-chlorophenyl)methyl N,N-diethylcarbamodithioate.
What is the SMILES notation for (2-chlorophenyl)methyl N,N-diethylcarbamodithioate?
The canonical SMILES for (2-chlorophenyl)methyl N,N-diethylcarbamodithioate is CCN(CC)C(=S)SCc1ccccc1Cl.
What is the InChIKey of (2-chlorophenyl)methyl N,N-diethylcarbamodithioate?
The InChIKey is UNBCSRFOAJMMAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClNS2/c1-3-14(4-2)12(15)16-9-10-7-5-6-8-11(10)13/h5-8H,3-4,9H2,1-2H3.
What are the key properties of (2-chlorophenyl)methyl N,N-diethylcarbamodithioate?
(2-chlorophenyl)methyl N,N-diethylcarbamodithioate has a molecular weight of 273.85 g/mol, XLogP of 4.20, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl)methyl N,N-diethylcarbamodithioate is sourced from PubChem (CID 101425594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).