C26H18N2O6S2-2 — CID 101425604
3-[2,9-dimethyl-7-(4-sulfonatophenyl)-1,10-phenanthrolin-4-yl]benzenesulfonate (PubChem CID 101425604) has the molecular formula C26H18N2O6S2-2 and a molecular weight of 518.57 g/mol. Its IUPAC name is 3-[2,9-dimethyl-7-(4-sulfonatophenyl)-1,10-phenanthrolin-4-yl]benzenesulfonate.
| Compound Name | 3-[2,9-dimethyl-7-(4-sulfonatophenyl)-1,10-phenanthrolin-4-yl]benzenesulfonate |
|---|---|
| PubChem CID | 101425604 |
| Molecular Formula | C26H18N2O6S2-2 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.06 |
| IUPAC Name | 3-[2,9-dimethyl-7-(4-sulfonatophenyl)-1,10-phenanthrolin-4-yl]benzenesulfonate |
| SMILES | Cc1cc(-c2ccc(S(=O)(=O)[O-])cc2)c2ccc3c(-c4cccc(S(=O)(=O)[O-])c4)cc(C)nc3c2n1 |
| InChI | InChI=1S/C26H20N2O6S2/c1-15-12-23(17-6-8-19(9-7-17)35(29,30)31)21-10-11-22-24(13-16(2)28-26(22)25(21)27-15)18-4-3-5-20(14-18)36(32,33)34/h3-14H,1-2H3,(H,29,30,31)(H,32,33,34)/p-2 |
| InChIKey | BGVNHXITJIMODX-UHFFFAOYSA-L |
| XLogP | 4.54 |
| TPSA | 140.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|