C18H40O3Si2 — CID 101425651
(2S,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpentanal (PubChem CID 101425651) has the molecular formula C18H40O3Si2 and a molecular weight of 360.69 g/mol. Its IUPAC name is (2S,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpentanal.
| Compound Name | (2S,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpentanal |
|---|---|
| PubChem CID | 101425651 |
| Molecular Formula | C18H40O3Si2 |
| Molecular Weight | 360.69 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | (2S,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpentanal |
| SMILES | C[C@H](C=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H40O3Si2/c1-14(13-19)16(21-23(11,12)18(6,7)8)15(2)20-22(9,10)17(3,4)5/h13-16H,1-12H3/t14-,15-,16+/m1/s1 |
| InChIKey | VEHNZQDSHQTHQD-OAGGEKHMSA-N |
| XLogP | 5.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.69 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|