C30H36N4O4 — CID 10142580
3-[[(2R)-3,3-dimethyl-2-[4-(pyridin-2-ylamino)butanoylamino]butanoyl]amino]-3-(4-phenylphenyl)propanoic acid (PubChem CID 10142580) has the molecular formula C30H36N4O4 and a molecular weight of 516.64 g/mol. Its IUPAC name is 3-[[(2R)-3,3-dimethyl-2-[4-(pyridin-2-ylamino)butanoylamino]butanoyl]amino]-3-(4-phenylphenyl)propanoic acid.
| Compound Name | 3-[[(2R)-3,3-dimethyl-2-[4-(pyridin-2-ylamino)butanoylamino]butanoyl]amino]-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 10142580 |
| Molecular Formula | C30H36N4O4 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 3-[[(2R)-3,3-dimethyl-2-[4-(pyridin-2-ylamino)butanoylamino]butanoyl]amino]-3-(4-phenylphenyl)propanoic acid |
| SMILES | CC(C)(C)[C@@H](NC(=O)CCCNc1ccccn1)C(=O)NC(CC(=O)O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H36N4O4/c1-30(2,3)28(34-26(35)13-9-19-32-25-12-7-8-18-31-25)29(38)33-24(20-27(36)37)23-16-14-22(15-17-23)21-10-5-4-6-11-21/h4-8,10-12,14-18,24,28H,9,13,19-20H2,1-3H3,(H,31,32)(H,33,38)(H,34,35)(H,36,37)/t24?,28-/m0/s1 |
| InChIKey | SAELZUPGKPASED-AZKKKJBWSA-N |
| XLogP | 4.80 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|