C30H36N4O4 — CID 10142581
3-[[(2R)-3-methyl-2-[5-(pyridin-2-ylamino)pentanoylamino]butanoyl]amino]-3-(4-phenylphenyl)propanoic acid (PubChem CID 10142581) has the molecular formula C30H36N4O4 and a molecular weight of 516.64 g/mol. Its IUPAC name is 3-[[(2R)-3-methyl-2-[5-(pyridin-2-ylamino)pentanoylamino]butanoyl]amino]-3-(4-phenylphenyl)propanoic acid.
| Compound Name | 3-[[(2R)-3-methyl-2-[5-(pyridin-2-ylamino)pentanoylamino]butanoyl]amino]-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 10142581 |
| Molecular Formula | C30H36N4O4 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 3-[[(2R)-3-methyl-2-[5-(pyridin-2-ylamino)pentanoylamino]butanoyl]amino]-3-(4-phenylphenyl)propanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)CCCCNc1ccccn1)C(=O)NC(CC(=O)O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H36N4O4/c1-21(2)29(34-27(35)13-7-9-19-32-26-12-6-8-18-31-26)30(38)33-25(20-28(36)37)24-16-14-23(15-17-24)22-10-4-3-5-11-22/h3-6,8,10-12,14-18,21,25,29H,7,9,13,19-20H2,1-2H3,(H,31,32)(H,33,38)(H,34,35)(H,36,37)/t25?,29-/m1/s1 |
| InChIKey | NODBRHWQWQOCEA-SNSSHHSLSA-N |
| XLogP | 4.80 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|