C16H20N2O4 — CID 101426207
3-[2-[(3,6-dihydroxycyclohexa-2,4-dien-1-yl)methylideneamino]ethyliminomethyl]cyclohexa-1,5-diene-1,4-diol (PubChem CID 101426207) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 3-[2-[(3,6-dihydroxycyclohexa-2,4-dien-1-yl)methylideneamino]ethyliminomethyl]cyclohexa-1,5-diene-1,4-diol.
| Compound Name | 3-[2-[(3,6-dihydroxycyclohexa-2,4-dien-1-yl)methylideneamino]ethyliminomethyl]cyclohexa-1,5-diene-1,4-diol |
|---|---|
| PubChem CID | 101426207 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 3-[2-[(3,6-dihydroxycyclohexa-2,4-dien-1-yl)methylideneamino]ethyliminomethyl]cyclohexa-1,5-diene-1,4-diol |
| SMILES | OC1=CC(/C=N/CC/N=C/C2C=C(O)C=CC2O)C(O)C=C1 |
| InChI | InChI=1S/C16H20N2O4/c19-13-1-3-15(21)11(7-13)9-17-5-6-18-10-12-8-14(20)2-4-16(12)22/h1-4,7-12,15-16,19-22H,5-6H2/b17-9+,18-10+ |
| InChIKey | YNZAAHVGIYCNNM-BEQMOXJMSA-N |
| XLogP | 1.11 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|