C30H33BF2N4 — CID 101426289
4-[(E)-2-[8-[4-(dimethylamino)phenyl]-2,2-difluoro-6,10,12-trimethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 101426289) has the molecular formula C30H33BF2N4 and a molecular weight of 498.43 g/mol. Its IUPAC name is 4-[(E)-2-[8-[4-(dimethylamino)phenyl]-2,2-difluoro-6,10,12-trimethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-[8-[4-(dimethylamino)phenyl]-2,2-difluoro-6,10,12-trimethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 101426289 |
| Molecular Formula | C30H33BF2N4 |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | 4-[(E)-2-[8-[4-(dimethylamino)phenyl]-2,2-difluoro-6,10,12-trimethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | CC1=CC(/C=C/c2ccc(N(C)C)cc2)=[N+]2C1=C(c1ccc(N(C)C)cc1)c1c(C)cc(C)n1[B-]2(F)F |
| InChI | InChI=1S/C30H33BF2N4/c1-20-18-22(3)36-29(20)28(24-11-16-26(17-12-24)35(6)7)30-21(2)19-27(37(30)31(36,32)33)15-10-23-8-13-25(14-9-23)34(4)5/h8-19H,1-7H3/b15-10+ |
| InChIKey | QSQWKXBAPUUZMO-XNTDXEJSSA-N |
| XLogP | 6.36 |
| TPSA | 14.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|