C30H38N2O12 — CID 101427068
2-[[(3R,4S,5R,6S)-6-acetyl-3,4,5-trihydroxyoxan-2-yl]-methoxyamino]-N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide (PubChem CID 101427068) has the molecular formula C30H38N2O12 and a molecular weight of 618.64 g/mol. Its IUPAC name is 2-[[(3R,4S,5R,6S)-6-acetyl-3,4,5-trihydroxyoxan-2-yl]-methoxyamino]-N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide.
| Compound Name | 2-[[(3R,4S,5R,6S)-6-acetyl-3,4,5-trihydroxyoxan-2-yl]-methoxyamino]-N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
|---|---|
| PubChem CID | 101427068 |
| Molecular Formula | C30H38N2O12 |
| Molecular Weight | 618.64 g/mol |
| Exact Mass | 618.24 |
| IUPAC Name | 2-[[(3R,4S,5R,6S)-6-acetyl-3,4,5-trihydroxyoxan-2-yl]-methoxyamino]-N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(OC)c(=O)cc1[C@@H](NC(=O)CN(OC)C1O[C@H](C(C)=O)[C@H](O)[C@H](O)[C@H]1O)CC2 |
| InChI | InChI=1S/C30H38N2O12/c1-14(33)27-25(37)24(36)26(38)30(44-27)32(43-6)13-22(35)31-18-9-7-15-11-21(40-3)28(41-4)29(42-5)23(15)16-8-10-20(39-2)19(34)12-17(16)18/h8,10-12,18,24-27,30,36-38H,7,9,13H2,1-6H3,(H,31,35)/t18-,24-,25+,26+,27+,30?/m0/s1 |
| InChIKey | GWDQZPJYQANFEV-DDJLWZGYSA-N |
| XLogP | 0.11 |
| TPSA | 182.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.64 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|