C29H49NO2 — CID 101427834
N-[(3,5-dioctoxyphenyl)methyl]-N-prop-2-enylprop-2-en-1-amine (PubChem CID 101427834) has the molecular formula C29H49NO2 and a molecular weight of 443.72 g/mol. Its IUPAC name is N-[(3,5-dioctoxyphenyl)methyl]-N-prop-2-enylprop-2-en-1-amine.
| Compound Name | N-[(3,5-dioctoxyphenyl)methyl]-N-prop-2-enylprop-2-en-1-amine |
|---|---|
| PubChem CID | 101427834 |
| Molecular Formula | C29H49NO2 |
| Molecular Weight | 443.72 g/mol |
| Exact Mass | 443.38 |
| IUPAC Name | N-[(3,5-dioctoxyphenyl)methyl]-N-prop-2-enylprop-2-en-1-amine |
| SMILES | C=CCN(CC=C)Cc1cc(OCCCCCCCC)cc(OCCCCCCCC)c1 |
| InChI | InChI=1S/C29H49NO2/c1-5-9-11-13-15-17-21-31-28-23-27(26-30(19-7-3)20-8-4)24-29(25-28)32-22-18-16-14-12-10-6-2/h7-8,23-25H,3-6,9-22,26H2,1-2H3 |
| InChIKey | CAOLHBCBEBENAG-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.72 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|