C14H18BrNO2 — CID 101428131
(5R)-5-(bromomethyl)-1-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]pyrrolidin-2-one (PubChem CID 101428131) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is (5R)-5-(bromomethyl)-1-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]pyrrolidin-2-one.
| Compound Name | (5R)-5-(bromomethyl)-1-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 101428131 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | (5R)-5-(bromomethyl)-1-[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]pyrrolidin-2-one |
| SMILES | C[C@@H]([C@H](O)c1ccccc1)N1C(=O)CC[C@@H]1CBr |
| InChI | InChI=1S/C14H18BrNO2/c1-10(14(18)11-5-3-2-4-6-11)16-12(9-15)7-8-13(16)17/h2-6,10,12,14,18H,7-9H2,1H3/t10-,12+,14-/m0/s1 |
| InChIKey | JZRBVHOQCJXPSK-SUHUHFCYSA-N |
| XLogP | 2.49 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|