C22H42O4Si — CID 101428154
ethyl 3-butoxy-7a-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,4,5,6,7-octahydroindene-1-carboxylate (PubChem CID 101428154) has the molecular formula C22H42O4Si and a molecular weight of 398.66 g/mol. Its IUPAC name is ethyl 3-butoxy-7a-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,4,5,6,7-octahydroindene-1-carboxylate.
| Compound Name | ethyl 3-butoxy-7a-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,4,5,6,7-octahydroindene-1-carboxylate |
|---|---|
| PubChem CID | 101428154 |
| Molecular Formula | C22H42O4Si |
| Molecular Weight | 398.66 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | ethyl 3-butoxy-7a-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,4,5,6,7-octahydroindene-1-carboxylate |
| SMILES | CCCCOC1CC(C(=O)OCC)C2(O[Si](C)(C)C(C)(C)C)CCCCC12 |
| InChI | InChI=1S/C22H42O4Si/c1-8-10-15-25-19-16-18(20(23)24-9-2)22(14-12-11-13-17(19)22)26-27(6,7)21(3,4)5/h17-19H,8-16H2,1-7H3 |
| InChIKey | UOALIPQZXAVSPQ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.66 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|