C25H20ClN5O4S — CID 10142819
5-amino-N-(5-chloro-2-pyridinyl)-2-[[4-(2-sulfamoylphenyl)benzoyl]amino]benzamide (PubChem CID 10142819) has the molecular formula C25H20ClN5O4S and a molecular weight of 521.99 g/mol. Its IUPAC name is 5-amino-N-(5-chloro-2-pyridinyl)-2-[[4-(2-sulfamoylphenyl)benzoyl]amino]benzamide.
| Compound Name | 5-amino-N-(5-chloro-2-pyridinyl)-2-[[4-(2-sulfamoylphenyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 10142819 |
| Molecular Formula | C25H20ClN5O4S |
| Molecular Weight | 521.99 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | 5-amino-N-(5-chloro-2-pyridinyl)-2-[[4-(2-sulfamoylphenyl)benzoyl]amino]benzamide |
| SMILES | Nc1ccc(NC(=O)c2ccc(-c3ccccc3S(N)(=O)=O)cc2)c(C(=O)Nc2ccc(Cl)cn2)c1 |
| InChI | InChI=1S/C25H20ClN5O4S/c26-17-9-12-23(29-14-17)31-25(33)20-13-18(27)10-11-21(20)30-24(32)16-7-5-15(6-8-16)19-3-1-2-4-22(19)36(28,34)35/h1-14H,27H2,(H,30,32)(H2,28,34,35)(H,29,31,33) |
| InChIKey | ZCSWLBURSBZESH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 157.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.99 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|