C14H17NO4 — CID 101428815
(2S,3aS,7R)-2-ethoxy-7-phenyl-3,3a,6,7-tetrahydro-2H-[1,2]oxazolo[3,2-c][1,4]oxazin-4-one (PubChem CID 101428815) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is (2S,3aS,7R)-2-ethoxy-7-phenyl-3,3a,6,7-tetrahydro-2H-[1,2]oxazolo[3,2-c][1,4]oxazin-4-one.
| Compound Name | (2S,3aS,7R)-2-ethoxy-7-phenyl-3,3a,6,7-tetrahydro-2H-[1,2]oxazolo[3,2-c][1,4]oxazin-4-one |
|---|---|
| PubChem CID | 101428815 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (2S,3aS,7R)-2-ethoxy-7-phenyl-3,3a,6,7-tetrahydro-2H-[1,2]oxazolo[3,2-c][1,4]oxazin-4-one |
| SMILES | CCO[C@@H]1C[C@H]2C(=O)OC[C@@H](c3ccccc3)N2O1 |
| InChI | InChI=1S/C14H17NO4/c1-2-17-13-8-11-14(16)18-9-12(15(11)19-13)10-6-4-3-5-7-10/h3-7,11-13H,2,8-9H2,1H3/t11-,12-,13-/m0/s1 |
| InChIKey | ZAEZNQXUNWJJQR-AVGNSLFASA-N |
| XLogP | 1.65 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |