C24H29NO8 — CID 101428854
[(1Z)-2,2-dimethoxy-1-[1-methyl-2-oxo-4-(1,5,8-trimethoxynaphthalen-2-yl)pyrrolidin-3-ylidene]ethyl] acetate (PubChem CID 101428854) has the molecular formula C24H29NO8 and a molecular weight of 459.50 g/mol. Its IUPAC name is [(1Z)-2,2-dimethoxy-1-[1-methyl-2-oxo-4-(1,5,8-trimethoxynaphthalen-2-yl)pyrrolidin-3-ylidene]ethyl] acetate.
| Compound Name | [(1Z)-2,2-dimethoxy-1-[1-methyl-2-oxo-4-(1,5,8-trimethoxynaphthalen-2-yl)pyrrolidin-3-ylidene]ethyl] acetate |
|---|---|
| PubChem CID | 101428854 |
| Molecular Formula | C24H29NO8 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | [(1Z)-2,2-dimethoxy-1-[1-methyl-2-oxo-4-(1,5,8-trimethoxynaphthalen-2-yl)pyrrolidin-3-ylidene]ethyl] acetate |
| SMILES | COc1ccc(OC)c2c(OC)c(C3CN(C)C(=O)/C3=C(\OC(C)=O)C(OC)OC)ccc12 |
| InChI | InChI=1S/C24H29NO8/c1-13(26)33-22(24(31-6)32-7)20-16(12-25(2)23(20)27)14-8-9-15-17(28-3)10-11-18(29-4)19(15)21(14)30-5/h8-11,16,24H,12H2,1-7H3/b22-20- |
| InChIKey | HUUHYBSFSIOOPI-XDOYNYLZSA-N |
| XLogP | 2.86 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|