C17H17NO4 — CID 101429488
(1R,2R,6R,10S,11S,15S)-7,7-dimethyl-17-oxa-13-azapentacyclo[8.5.1.12,6.01,8.011,15]heptadeca-4,8-diene-3,12,14-trione (PubChem CID 101429488) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is (1R,2R,6R,10S,11S,15S)-7,7-dimethyl-17-oxa-13-azapentacyclo[8.5.1.12,6.01,8.011,15]heptadeca-4,8-diene-3,12,14-trione.
| Compound Name | (1R,2R,6R,10S,11S,15S)-7,7-dimethyl-17-oxa-13-azapentacyclo[8.5.1.12,6.01,8.011,15]heptadeca-4,8-diene-3,12,14-trione |
|---|---|
| PubChem CID | 101429488 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (1R,2R,6R,10S,11S,15S)-7,7-dimethyl-17-oxa-13-azapentacyclo[8.5.1.12,6.01,8.011,15]heptadeca-4,8-diene-3,12,14-trione |
| SMILES | CC1(C)C2=C[C@@H]3C[C@@]2([C@H]2O[C@@H]1C=CC2=O)[C@H]1C(=O)NC(=O)[C@@H]31 |
| InChI | InChI=1S/C17H17NO4/c1-16(2)9-5-7-6-17(9,12-11(7)14(20)18-15(12)21)13-8(19)3-4-10(16)22-13/h3-5,7,10-13H,6H2,1-2H3,(H,18,20,21)/t7-,10-,11+,12-,13+,17+/m1/s1 |
| InChIKey | OTUHHISNCCLXKA-JXQWQGGRSA-N |
| XLogP | 0.75 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|