C30H25F3O5 — CID 101430018
(7R,11S)-3,3-dimethyl-7-phenyl-11-[4-[4-(trifluoromethyl)phenyl]phenyl]-2,4-dioxaspiro[5.5]undecane-1,5,9-trione (PubChem CID 101430018) has the molecular formula C30H25F3O5 and a molecular weight of 522.52 g/mol. Its IUPAC name is (7R,11S)-3,3-dimethyl-7-phenyl-11-[4-[4-(trifluoromethyl)phenyl]phenyl]-2,4-dioxaspiro[5.5]undecane-1,5,9-trione.
| Compound Name | (7R,11S)-3,3-dimethyl-7-phenyl-11-[4-[4-(trifluoromethyl)phenyl]phenyl]-2,4-dioxaspiro[5.5]undecane-1,5,9-trione |
|---|---|
| PubChem CID | 101430018 |
| Molecular Formula | C30H25F3O5 |
| Molecular Weight | 522.52 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | (7R,11S)-3,3-dimethyl-7-phenyl-11-[4-[4-(trifluoromethyl)phenyl]phenyl]-2,4-dioxaspiro[5.5]undecane-1,5,9-trione |
| SMILES | CC1(C)OC(=O)C2(C(=O)O1)[C@@H](c1ccccc1)CC(=O)C[C@H]2c1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C30H25F3O5/c1-28(2)37-26(35)29(27(36)38-28)24(20-6-4-3-5-7-20)16-23(34)17-25(29)21-10-8-18(9-11-21)19-12-14-22(15-13-19)30(31,32)33/h3-15,24-25H,16-17H2,1-2H3/t24-,25+/m1/s1 |
| InChIKey | AYOQMZZMPZARHB-RPBOFIJWSA-N |
| XLogP | 6.43 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.52 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|