C36H96N15P3+6 — CID 101430161
trimethyl-[3-[[2,4,4,6,6-pentakis[3-(trimethylazaniumyl)propylamino]-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl]amino]propyl]azanium (PubChem CID 101430161) has the molecular formula C36H96N15P3+6 and a molecular weight of 832.19 g/mol. Its IUPAC name is trimethyl-[3-[[2,4,4,6,6-pentakis[3-(trimethylazaniumyl)propylamino]-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl]amino]propyl]azanium.
| Compound Name | trimethyl-[3-[[2,4,4,6,6-pentakis[3-(trimethylazaniumyl)propylamino]-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl]amino]propyl]azanium |
|---|---|
| PubChem CID | 101430161 |
| Molecular Formula | C36H96N15P3+6 |
| Molecular Weight | 832.19 g/mol |
| Exact Mass | 831.72 |
| IUPAC Name | trimethyl-[3-[[2,4,4,6,6-pentakis[3-(trimethylazaniumyl)propylamino]-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl]amino]propyl]azanium |
| SMILES | C[N+](C)(C)CCCNP1(NCCC[N+](C)(C)C)=NP(NCCC[N+](C)(C)C)(NCCC[N+](C)(C)C)=NP(NCCC[N+](C)(C)C)(NCCC[N+](C)(C)C)=N1 |
| InChI | InChI=1S/C36H96N15P3/c1-46(2,3)31-19-25-37-52(38-26-20-32-47(4,5)6)43-53(39-27-21-33-48(7,8)9,40-28-22-34-49(10,11)12)45-54(44-52,41-29-23-35-50(13,14)15)42-30-24-36-51(16,17)18/h37-42H,19-36H2,1-18H3/q+6 |
| InChIKey | BWSPAOLQKCVJJV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 109.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.19 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|