C18H39N5O2 — CID 101430189
N-(2-aminoethyl)-3-[[3-(2-aminoethylamino)-3-oxopropyl]-octylamino]propanamide (PubChem CID 101430189) has the molecular formula C18H39N5O2 and a molecular weight of 357.54 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-[[3-(2-aminoethylamino)-3-oxopropyl]-octylamino]propanamide.
| Compound Name | N-(2-aminoethyl)-3-[[3-(2-aminoethylamino)-3-oxopropyl]-octylamino]propanamide |
|---|---|
| PubChem CID | 101430189 |
| Molecular Formula | C18H39N5O2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.31 |
| IUPAC Name | N-(2-aminoethyl)-3-[[3-(2-aminoethylamino)-3-oxopropyl]-octylamino]propanamide |
| SMILES | CCCCCCCCN(CCC(=O)NCCN)CCC(=O)NCCN |
| InChI | InChI=1S/C18H39N5O2/c1-2-3-4-5-6-7-14-23(15-8-17(24)21-12-10-19)16-9-18(25)22-13-11-20/h2-16,19-20H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | LFVLHGMRNZXESP-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|