About (2S,6R)-4-azido-2,6-diphenyloxane
(2S,6R)-4-azido-2,6-diphenyloxane (PubChem CID 101430483) has the molecular formula C17H17N3O
and a molecular weight of 279.34 g/mol. Its IUPAC name is (2S,6R)-4-azido-2,6-diphenyloxane.
Molecular Properties
| Compound Name | (2S,6R)-4-azido-2,6-diphenyloxane |
| PubChem CID | 101430483 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (2S,6R)-4-azido-2,6-diphenyloxane |
| SMILES | [N-]=[N+]=NC1C[C@@H](c2ccccc2)O[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C17H17N3O/c18-20-19-15-11-16(13-7-3-1-4-8-13)21-17(12-15)14-9-5-2-6-10-14/h1-10,15-17H,11-12H2/t15?,16-,17+ |
| InChIKey | BSULJHUIRXQOLS-ALOPSCKCSA-N |
| XLogP | 4.96 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (2S,6R)-4-azido-2,6-diphenyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6R)-4-azido-2,6-diphenyloxane?
The IUPAC name of (2S,6R)-4-azido-2,6-diphenyloxane (CID 101430483) is (2S,6R)-4-azido-2,6-diphenyloxane.
What is the SMILES notation for (2S,6R)-4-azido-2,6-diphenyloxane?
The canonical SMILES for (2S,6R)-4-azido-2,6-diphenyloxane is [N-]=[N+]=NC1C[C@@H](c2ccccc2)O[C@@H](c2ccccc2)C1.
What is the InChIKey of (2S,6R)-4-azido-2,6-diphenyloxane?
The InChIKey is BSULJHUIRXQOLS-ALOPSCKCSA-N. The full InChI is InChI=1S/C17H17N3O/c18-20-19-15-11-16(13-7-3-1-4-8-13)21-17(12-15)14-9-5-2-6-10-14/h1-10,15-17H,11-12H2/t15?,16-,17+.
What are the key properties of (2S,6R)-4-azido-2,6-diphenyloxane?
(2S,6R)-4-azido-2,6-diphenyloxane has a molecular weight of 279.34 g/mol, XLogP of 4.96, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6R)-4-azido-2,6-diphenyloxane is sourced from PubChem (CID 101430483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).