C28H21FN4O4S — CID 10143087
N-[2-(1-aminoisoquinolin-7-yl)oxy-5-fluorophenyl]-4-(2-sulfamoylphenyl)benzamide (PubChem CID 10143087) has the molecular formula C28H21FN4O4S and a molecular weight of 528.57 g/mol. Its IUPAC name is N-[2-(1-aminoisoquinolin-7-yl)oxy-5-fluorophenyl]-4-(2-sulfamoylphenyl)benzamide.
| Compound Name | N-[2-(1-aminoisoquinolin-7-yl)oxy-5-fluorophenyl]-4-(2-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 10143087 |
| Molecular Formula | C28H21FN4O4S |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | N-[2-(1-aminoisoquinolin-7-yl)oxy-5-fluorophenyl]-4-(2-sulfamoylphenyl)benzamide |
| SMILES | Nc1nccc2ccc(Oc3ccc(F)cc3NC(=O)c3ccc(-c4ccccc4S(N)(=O)=O)cc3)cc12 |
| InChI | InChI=1S/C28H21FN4O4S/c29-20-10-12-25(37-21-11-9-18-13-14-32-27(30)23(18)16-21)24(15-20)33-28(34)19-7-5-17(6-8-19)22-3-1-2-4-26(22)38(31,35)36/h1-16H,(H2,30,32)(H,33,34)(H2,31,35,36) |
| InChIKey | IJWFYXNPCKRWPH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 137.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |