C19H28FNO3 — CID 101430933
[2-(4-fluorophenyl)-1-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethyl] acetate (PubChem CID 101430933) has the molecular formula C19H28FNO3 and a molecular weight of 337.44 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-1-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethyl] acetate.
| Compound Name | [2-(4-fluorophenyl)-1-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethyl] acetate |
|---|---|
| PubChem CID | 101430933 |
| Molecular Formula | C19H28FNO3 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | [2-(4-fluorophenyl)-1-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethyl] acetate |
| SMILES | CC(=O)OC(Cc1ccc(F)cc1)ON1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C19H28FNO3/c1-14(22)23-17(13-15-7-9-16(20)10-8-15)24-21-18(2,3)11-6-12-19(21,4)5/h7-10,17H,6,11-13H2,1-5H3 |
| InChIKey | GVNKHWIVWJWHAH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|