C25H27NO2 — CID 101431558
(1S,9S,12S)-8-benzyl-12-butyl-10-methyl-13-oxa-8-azatetracyclo[7.6.0.01,12.02,7]pentadeca-2,4,6,10-tetraen-14-one (PubChem CID 101431558) has the molecular formula C25H27NO2 and a molecular weight of 373.50 g/mol. Its IUPAC name is (1S,9S,12S)-8-benzyl-12-butyl-10-methyl-13-oxa-8-azatetracyclo[7.6.0.01,12.02,7]pentadeca-2,4,6,10-tetraen-14-one.
| Compound Name | (1S,9S,12S)-8-benzyl-12-butyl-10-methyl-13-oxa-8-azatetracyclo[7.6.0.01,12.02,7]pentadeca-2,4,6,10-tetraen-14-one |
|---|---|
| PubChem CID | 101431558 |
| Molecular Formula | C25H27NO2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | (1S,9S,12S)-8-benzyl-12-butyl-10-methyl-13-oxa-8-azatetracyclo[7.6.0.01,12.02,7]pentadeca-2,4,6,10-tetraen-14-one |
| SMILES | CCCC[C@]12C=C(C)[C@@H]3N(Cc4ccccc4)c4ccccc4[C@@]31CC(=O)O2 |
| InChI | InChI=1S/C25H27NO2/c1-3-4-14-24-15-18(2)23-25(24,16-22(27)28-24)20-12-8-9-13-21(20)26(23)17-19-10-6-5-7-11-19/h5-13,15,23H,3-4,14,16-17H2,1-2H3/t23-,24-,25-/m0/s1 |
| InChIKey | ALCJAHHYMBOWSW-SDHOMARFSA-N |
| XLogP | 5.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|