C24H33F3N4O6 — CID 10143180
(6S,7R,10S)-6-N-hydroxy-7-(2-methylpropyl)-8-oxo-10-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-oxa-9-azabicyclo[10.2.2]hexadeca-1(14),12,15-triene-6,10-dicarboxamide (PubChem CID 10143180) has the molecular formula C24H33F3N4O6 and a molecular weight of 530.54 g/mol. Its IUPAC name is (6S,7R,10S)-6-N-hydroxy-7-(2-methylpropyl)-8-oxo-10-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-oxa-9-azabicyclo[10.2.2]hexadeca-1(14),12,15-triene-6,10-dicarboxamide.
| Compound Name | (6S,7R,10S)-6-N-hydroxy-7-(2-methylpropyl)-8-oxo-10-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-oxa-9-azabicyclo[10.2.2]hexadeca-1(14),12,15-triene-6,10-dicarboxamide |
|---|---|
| PubChem CID | 10143180 |
| Molecular Formula | C24H33F3N4O6 |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | (6S,7R,10S)-6-N-hydroxy-7-(2-methylpropyl)-8-oxo-10-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-2-oxa-9-azabicyclo[10.2.2]hexadeca-1(14),12,15-triene-6,10-dicarboxamide |
| SMILES | CC(C)C[C@H]1C(=O)N[C@H](C(=O)NCC(=O)NCC(F)(F)F)Cc2ccc(cc2)OCCC[C@@H]1C(=O)NO |
| InChI | InChI=1S/C24H33F3N4O6/c1-14(2)10-18-17(22(34)31-36)4-3-9-37-16-7-5-15(6-8-16)11-19(30-21(18)33)23(35)28-12-20(32)29-13-24(25,26)27/h5-8,14,17-19,36H,3-4,9-13H2,1-2H3,(H,28,35)(H,29,32)(H,30,33)(H,31,34)/t17-,18+,19-/m0/s1 |
| InChIKey | FKXCWQZPUJRQQO-OTWHNJEPSA-N |
| XLogP | 1.47 |
| TPSA | 145.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|