C42H52N2O2 — CID 101431943
2,9-bis(3,5-ditert-butyl-4-methoxyphenyl)-1,10-phenanthroline (PubChem CID 101431943) has the molecular formula C42H52N2O2 and a molecular weight of 616.89 g/mol. Its IUPAC name is 2,9-bis(3,5-ditert-butyl-4-methoxyphenyl)-1,10-phenanthroline.
| Compound Name | 2,9-bis(3,5-ditert-butyl-4-methoxyphenyl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 101431943 |
| Molecular Formula | C42H52N2O2 |
| Molecular Weight | 616.89 g/mol |
| Exact Mass | 616.40 |
| IUPAC Name | 2,9-bis(3,5-ditert-butyl-4-methoxyphenyl)-1,10-phenanthroline |
| SMILES | COc1c(C(C)(C)C)cc(-c2ccc3ccc4ccc(-c5cc(C(C)(C)C)c(OC)c(C(C)(C)C)c5)nc4c3n2)cc1C(C)(C)C |
| InChI | InChI=1S/C42H52N2O2/c1-39(2,3)29-21-27(22-30(37(29)45-13)40(4,5)6)33-19-17-25-15-16-26-18-20-34(44-36(26)35(25)43-33)28-23-31(41(7,8)9)38(46-14)32(24-28)42(10,11)12/h15-24H,1-14H3 |
| InChIKey | XYOUZEDTUOJHQP-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.89 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|