C31H38N4O4 — CID 10143202
3-(4-phenylphenyl)-3-[[(2S)-2-[5-(pyridin-2-ylamino)pentanoylamino]hexanoyl]amino]propanoic acid (PubChem CID 10143202) has the molecular formula C31H38N4O4 and a molecular weight of 530.67 g/mol. Its IUPAC name is 3-(4-phenylphenyl)-3-[[(2S)-2-[5-(pyridin-2-ylamino)pentanoylamino]hexanoyl]amino]propanoic acid.
| Compound Name | 3-(4-phenylphenyl)-3-[[(2S)-2-[5-(pyridin-2-ylamino)pentanoylamino]hexanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10143202 |
| Molecular Formula | C31H38N4O4 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | 3-(4-phenylphenyl)-3-[[(2S)-2-[5-(pyridin-2-ylamino)pentanoylamino]hexanoyl]amino]propanoic acid |
| SMILES | CCCC[C@H](NC(=O)CCCCNc1ccccn1)C(=O)NC(CC(=O)O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H38N4O4/c1-2-3-13-26(34-29(36)15-8-10-21-33-28-14-7-9-20-32-28)31(39)35-27(22-30(37)38)25-18-16-24(17-19-25)23-11-5-4-6-12-23/h4-7,9,11-12,14,16-20,26-27H,2-3,8,10,13,15,21-22H2,1H3,(H,32,33)(H,34,36)(H,35,39)(H,37,38)/t26-,27?/m0/s1 |
| InChIKey | NIDKKNKVEVPZID-QBHOUYDASA-N |
| XLogP | 5.34 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|