C34H22F4 — CID 101432026
6,6,12,12-tetrafluoro-2,8-bis(4-methylphenyl)indeno[1,2-b]fluorene (PubChem CID 101432026) has the molecular formula C34H22F4 and a molecular weight of 506.54 g/mol. Its IUPAC name is 6,6,12,12-tetrafluoro-2,8-bis(4-methylphenyl)indeno[1,2-b]fluorene.
| Compound Name | 6,6,12,12-tetrafluoro-2,8-bis(4-methylphenyl)indeno[1,2-b]fluorene |
|---|---|
| PubChem CID | 101432026 |
| Molecular Formula | C34H22F4 |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 6,6,12,12-tetrafluoro-2,8-bis(4-methylphenyl)indeno[1,2-b]fluorene |
| SMILES | Cc1ccc(-c2ccc3c(c2)C(F)(F)c2cc4c(cc2-3)C(F)(F)c2cc(-c3ccc(C)cc3)ccc2-4)cc1 |
| InChI | InChI=1S/C34H22F4/c1-19-3-7-21(8-4-19)23-11-13-25-27-17-32-28(18-31(27)33(35,36)29(25)15-23)26-14-12-24(16-30(26)34(32,37)38)22-9-5-20(2)6-10-22/h3-18H,1-2H3 |
| InChIKey | UCHUJZKPVUTNCX-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |