About 1,5-dichloro-2,3,4-trifluorobenzene-6-ide
1,5-dichloro-2,3,4-trifluorobenzene-6-ide (PubChem CID 101432351) has the molecular formula C6Cl2F3-
and a molecular weight of 199.97 g/mol. Its IUPAC name is 1,5-dichloro-2,3,4-trifluorobenzene-6-ide.
Molecular Properties
| Compound Name | 1,5-dichloro-2,3,4-trifluorobenzene-6-ide |
| PubChem CID | 101432351 |
| Molecular Formula | C6Cl2F3- |
| Molecular Weight | 199.97 g/mol |
| Exact Mass | 198.93 |
| IUPAC Name | 1,5-dichloro-2,3,4-trifluorobenzene-6-ide |
| SMILES | Fc1c(Cl)[c-]c(Cl)c(F)c1F |
| InChI | InChI=1S/C6Cl2F3/c7-2-1-3(8)5(10)6(11)4(2)9/q-1 |
| InChIKey | IQRNKPGUHNGTJT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.97 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dichloro-2,3,4-trifluorobenzene-6-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dichloro-2,3,4-trifluorobenzene-6-ide?
The IUPAC name of 1,5-dichloro-2,3,4-trifluorobenzene-6-ide (CID 101432351) is 1,5-dichloro-2,3,4-trifluorobenzene-6-ide.
What is the SMILES notation for 1,5-dichloro-2,3,4-trifluorobenzene-6-ide?
The canonical SMILES for 1,5-dichloro-2,3,4-trifluorobenzene-6-ide is Fc1c(Cl)[c-]c(Cl)c(F)c1F.
What is the InChIKey of 1,5-dichloro-2,3,4-trifluorobenzene-6-ide?
The InChIKey is IQRNKPGUHNGTJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6Cl2F3/c7-2-1-3(8)5(10)6(11)4(2)9/q-1.
What are the key properties of 1,5-dichloro-2,3,4-trifluorobenzene-6-ide?
1,5-dichloro-2,3,4-trifluorobenzene-6-ide has a molecular weight of 199.97 g/mol, XLogP of 3.21, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dichloro-2,3,4-trifluorobenzene-6-ide is sourced from PubChem (CID 101432351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).