About 5-[1,1-difluoro-3-[(2-methylpropan-2-yl)oxy]propyl]-3-methyl-1,3-oxazolidin-2-one
5-[1,1-difluoro-3-[(2-methylpropan-2-yl)oxy]propyl]-3-methyl-1,3-oxazolidin-2-one (PubChem CID 101432697) has the molecular formula C11H19F2NO3
and a molecular weight of 251.27 g/mol. Its IUPAC name is 5-[1,1-difluoro-3-[(2-methylpropan-2-yl)oxy]propyl]-3-methyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 5-[1,1-difluoro-3-[(2-methylpropan-2-yl)oxy]propyl]-3-methyl-1,3-oxazolidin-2-one |
| PubChem CID | 101432697 |
| Molecular Formula | C11H19F2NO3 |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 5-[1,1-difluoro-3-[(2-methylpropan-2-yl)oxy]propyl]-3-methyl-1,3-oxazolidin-2-one |
| SMILES | CN1CC(C(F)(F)CCOC(C)(C)C)OC1=O |
| InChI | InChI=1S/C11H19F2NO3/c1-10(2,3)16-6-5-11(12,13)8-7-14(4)9(15)17-8/h8H,5-7H2,1-4H3 |
| InChIKey | RMGHWWHBTAHJBX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[1,1-difluoro-3-[(2-methylpropan-2-yl)oxy]propyl]-3-methyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1,1-difluoro-3-[(2-methylpropan-2-yl)oxy]propyl]-3-methyl-1,3-oxazolidin-2-one?
The IUPAC name of 5-[1,1-difluoro-3-[(2-methylpropan-2-yl)oxy]propyl]-3-methyl-1,3-oxazolidin-2-one (CID 101432697) is 5-[1,1-difluoro-3-[(2-methylpropan-2-yl)oxy]propyl]-3-methyl-1,3-oxazolidin-2-one.
What is the SMILES notation for 5-[1,1-difluoro-3-[(2-methylpropan-2-yl)oxy]propyl]-3-methyl-1,3-oxazolidin-2-one?
The canonical SMILES for 5-[1,1-difluoro-3-[(2-methylpropan-2-yl)oxy]propyl]-3-methyl-1,3-oxazolidin-2-one is CN1CC(C(F)(F)CCOC(C)(C)C)OC1=O.
What is the InChIKey of 5-[1,1-difluoro-3-[(2-methylpropan-2-yl)oxy]propyl]-3-methyl-1,3-oxazolidin-2-one?
The InChIKey is RMGHWWHBTAHJBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F2NO3/c1-10(2,3)16-6-5-11(12,13)8-7-14(4)9(15)17-8/h8H,5-7H2,1-4H3.
What are the key properties of 5-[1,1-difluoro-3-[(2-methylpropan-2-yl)oxy]propyl]-3-methyl-1,3-oxazolidin-2-one?
5-[1,1-difluoro-3-[(2-methylpropan-2-yl)oxy]propyl]-3-methyl-1,3-oxazolidin-2-one has a molecular weight of 251.27 g/mol, XLogP of 2.28, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1,1-difluoro-3-[(2-methylpropan-2-yl)oxy]propyl]-3-methyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 101432697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).