About CID 101433073
CID 101433073 (PubChem CID 101433073) has the molecular formula C28H35ClN2O+
and a molecular weight of 451.05 g/mol.
Molecular Properties
| Compound Name | CID 101433073 |
| PubChem CID | 101433073 |
| Molecular Formula | C28H35ClN2O+ |
| Molecular Weight | 451.05 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | — |
| SMILES | CCC[n+]1ccc(-c2cc(-c3ccc(Cl)cc3)c([N]OC(C)(C)C)c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C28H35ClN2O/c1-8-15-31-16-13-20(14-17-31)22-18-24(21-9-11-23(29)12-10-21)26(30-32-28(5,6)7)25(19-22)27(2,3)4/h9-14,16-19H,8,15H2,1-7H3/q+1 |
| InChIKey | UCXFZVRNTVRWBU-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 27.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.05 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 101433073 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101433073?
The IUPAC name of CID 101433073 (CID 101433073) is not available.
What is the SMILES notation for CID 101433073?
The canonical SMILES for CID 101433073 is CCC[n+]1ccc(-c2cc(-c3ccc(Cl)cc3)c([N]OC(C)(C)C)c(C(C)(C)C)c2)cc1.
What is the InChIKey of CID 101433073?
The InChIKey is UCXFZVRNTVRWBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H35ClN2O/c1-8-15-31-16-13-20(14-17-31)22-18-24(21-9-11-23(29)12-10-21)26(30-32-28(5,6)7)25(19-22)27(2,3)4/h9-14,16-19H,8,15H2,1-7H3/q+1.
What are the key properties of CID 101433073?
CID 101433073 has a molecular weight of 451.05 g/mol, XLogP of 7.64, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101433073 is sourced from PubChem (CID 101433073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).