C13H15NOS2 — CID 101433700
(4R,5R)-2-ethylsulfanyl-5-methyl-4-phenyl-4,5-dihydro-1,3-thiazin-6-one (PubChem CID 101433700) has the molecular formula C13H15NOS2 and a molecular weight of 265.40 g/mol. Its IUPAC name is (4R,5R)-2-ethylsulfanyl-5-methyl-4-phenyl-4,5-dihydro-1,3-thiazin-6-one.
| Compound Name | (4R,5R)-2-ethylsulfanyl-5-methyl-4-phenyl-4,5-dihydro-1,3-thiazin-6-one |
|---|---|
| PubChem CID | 101433700 |
| Molecular Formula | C13H15NOS2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | (4R,5R)-2-ethylsulfanyl-5-methyl-4-phenyl-4,5-dihydro-1,3-thiazin-6-one |
| SMILES | CCSC1=N[C@@H](c2ccccc2)[C@@H](C)C(=O)S1 |
| InChI | InChI=1S/C13H15NOS2/c1-3-16-13-14-11(9(2)12(15)17-13)10-7-5-4-6-8-10/h4-9,11H,3H2,1-2H3/t9-,11-/m1/s1 |
| InChIKey | XLBWOERVGNTROX-MWLCHTKSSA-N |
| XLogP | 3.75 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|