About 2-[[4-(1,3-dithian-2-yl)phenoxy]methyl]-2-methyl-1,3-dithiane
2-[[4-(1,3-dithian-2-yl)phenoxy]methyl]-2-methyl-1,3-dithiane (PubChem CID 101433893) has the molecular formula C16H22OS4
and a molecular weight of 358.62 g/mol. Its IUPAC name is 2-[[4-(1,3-dithian-2-yl)phenoxy]methyl]-2-methyl-1,3-dithiane.
Molecular Properties
| Compound Name | 2-[[4-(1,3-dithian-2-yl)phenoxy]methyl]-2-methyl-1,3-dithiane |
| PubChem CID | 101433893 |
| Molecular Formula | C16H22OS4 |
| Molecular Weight | 358.62 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 2-[[4-(1,3-dithian-2-yl)phenoxy]methyl]-2-methyl-1,3-dithiane |
| SMILES | CC1(COc2ccc(C3SCCCS3)cc2)SCCCS1 |
| InChI | InChI=1S/C16H22OS4/c1-16(20-10-3-11-21-16)12-17-14-6-4-13(5-7-14)15-18-8-2-9-19-15/h4-7,15H,2-3,8-12H2,1H3 |
| InChIKey | FDNQIMXNFAYWDS-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.62 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[4-(1,3-dithian-2-yl)phenoxy]methyl]-2-methyl-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(1,3-dithian-2-yl)phenoxy]methyl]-2-methyl-1,3-dithiane?
The IUPAC name of 2-[[4-(1,3-dithian-2-yl)phenoxy]methyl]-2-methyl-1,3-dithiane (CID 101433893) is 2-[[4-(1,3-dithian-2-yl)phenoxy]methyl]-2-methyl-1,3-dithiane.
What is the SMILES notation for 2-[[4-(1,3-dithian-2-yl)phenoxy]methyl]-2-methyl-1,3-dithiane?
The canonical SMILES for 2-[[4-(1,3-dithian-2-yl)phenoxy]methyl]-2-methyl-1,3-dithiane is CC1(COc2ccc(C3SCCCS3)cc2)SCCCS1.
What is the InChIKey of 2-[[4-(1,3-dithian-2-yl)phenoxy]methyl]-2-methyl-1,3-dithiane?
The InChIKey is FDNQIMXNFAYWDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22OS4/c1-16(20-10-3-11-21-16)12-17-14-6-4-13(5-7-14)15-18-8-2-9-19-15/h4-7,15H,2-3,8-12H2,1H3.
What are the key properties of 2-[[4-(1,3-dithian-2-yl)phenoxy]methyl]-2-methyl-1,3-dithiane?
2-[[4-(1,3-dithian-2-yl)phenoxy]methyl]-2-methyl-1,3-dithiane has a molecular weight of 358.62 g/mol, XLogP of 5.52, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(1,3-dithian-2-yl)phenoxy]methyl]-2-methyl-1,3-dithiane is sourced from PubChem (CID 101433893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).