C32H36NO5P — CID 101434237
tert-butyl (4S)-4-[(Z)-3-(2-diphenylphosphanylbenzoyl)oxyprop-1-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 101434237) has the molecular formula C32H36NO5P and a molecular weight of 545.62 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(Z)-3-(2-diphenylphosphanylbenzoyl)oxyprop-1-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(Z)-3-(2-diphenylphosphanylbenzoyl)oxyprop-1-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 101434237 |
| Molecular Formula | C32H36NO5P |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | tert-butyl (4S)-4-[(Z)-3-(2-diphenylphosphanylbenzoyl)oxyprop-1-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](/C=C\COC(=O)c2ccccc2P(c2ccccc2)c2ccccc2)COC1(C)C |
| InChI | InChI=1S/C32H36NO5P/c1-31(2,3)38-30(35)33-24(23-37-32(33,4)5)15-14-22-36-29(34)27-20-12-13-21-28(27)39(25-16-8-6-9-17-25)26-18-10-7-11-19-26/h6-21,24H,22-23H2,1-5H3/b15-14-/t24-/m0/s1 |
| InChIKey | WNGYJXYAGYSCMA-XYSUMVETSA-N |
| XLogP | 5.53 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|