C11H5BF3NO2 — CID 101434287
2-(1,3,2-benzodioxaborol-2-yl)-3,5,6-trifluoropyridine (PubChem CID 101434287) has the molecular formula C11H5BF3NO2 and a molecular weight of 250.97 g/mol. Its IUPAC name is 2-(1,3,2-benzodioxaborol-2-yl)-3,5,6-trifluoropyridine.
| Compound Name | 2-(1,3,2-benzodioxaborol-2-yl)-3,5,6-trifluoropyridine |
|---|---|
| PubChem CID | 101434287 |
| Molecular Formula | C11H5BF3NO2 |
| Molecular Weight | 250.97 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 2-(1,3,2-benzodioxaborol-2-yl)-3,5,6-trifluoropyridine |
| SMILES | Fc1cc(F)c(B2Oc3ccccc3O2)nc1F |
| InChI | InChI=1S/C11H5BF3NO2/c13-6-5-7(14)11(15)16-10(6)12-17-8-3-1-2-4-9(8)18-12/h1-5H |
| InChIKey | CNSGKCVQLCEZIR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.97 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|