C17H20N2O4S — CID 101434436
4-nitro-N-(2,3,4,5,6-pentamethylphenyl)benzenesulfonamide (PubChem CID 101434436) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is 4-nitro-N-(2,3,4,5,6-pentamethylphenyl)benzenesulfonamide.
| Compound Name | 4-nitro-N-(2,3,4,5,6-pentamethylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 101434436 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 4-nitro-N-(2,3,4,5,6-pentamethylphenyl)benzenesulfonamide |
| SMILES | Cc1c(C)c(C)c(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)c(C)c1C |
| InChI | InChI=1S/C17H20N2O4S/c1-10-11(2)13(4)17(14(5)12(10)3)18-24(22,23)16-8-6-15(7-9-16)19(20)21/h6-9,18H,1-5H3 |
| InChIKey | GEMGNJKMYUPBQU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|