C26H21O6P — CID 101434455
dimethyl 2-(3,3'-spirobi[2-oxa-3λ5-phosphatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene]-3-yl)butanedioate (PubChem CID 101434455) has the molecular formula C26H21O6P and a molecular weight of 460.42 g/mol. Its IUPAC name is dimethyl 2-(3,3'-spirobi[2-oxa-3λ5-phosphatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene]-3-yl)butanedioate.
| Compound Name | dimethyl 2-(3,3'-spirobi[2-oxa-3λ5-phosphatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene]-3-yl)butanedioate |
|---|---|
| PubChem CID | 101434455 |
| Molecular Formula | C26H21O6P |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | dimethyl 2-(3,3'-spirobi[2-oxa-3λ5-phosphatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene]-3-yl)butanedioate |
| SMILES | COC(=O)CC(C(=O)OC)P12(Oc3cccc4cccc1c34)Oc1cccc3cccc2c13 |
| InChI | InChI=1S/C26H21O6P/c1-29-23(27)15-22(26(28)30-2)33(20-13-5-9-16-7-3-11-18(31-33)24(16)20)21-14-6-10-17-8-4-12-19(32-33)25(17)21/h3-14,22H,15H2,1-2H3 |
| InChIKey | SREFIFYQVVASCZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|