C22H23N3OS — CID 101434726
(4R,6S)-5-(2,2-dimethylpropanoyl)-4,6-diphenyl-2-sulfanylidene-1,3-diazinane-5-carbonitrile (PubChem CID 101434726) has the molecular formula C22H23N3OS and a molecular weight of 377.51 g/mol. Its IUPAC name is (4R,6S)-5-(2,2-dimethylpropanoyl)-4,6-diphenyl-2-sulfanylidene-1,3-diazinane-5-carbonitrile.
| Compound Name | (4R,6S)-5-(2,2-dimethylpropanoyl)-4,6-diphenyl-2-sulfanylidene-1,3-diazinane-5-carbonitrile |
|---|---|
| PubChem CID | 101434726 |
| Molecular Formula | C22H23N3OS |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (4R,6S)-5-(2,2-dimethylpropanoyl)-4,6-diphenyl-2-sulfanylidene-1,3-diazinane-5-carbonitrile |
| SMILES | CC(C)(C)C(=O)C1(C#N)[C@@H](c2ccccc2)NC(=S)N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H23N3OS/c1-21(2,3)19(26)22(14-23)17(15-10-6-4-7-11-15)24-20(27)25-18(22)16-12-8-5-9-13-16/h4-13,17-18H,1-3H3,(H2,24,25,27)/t17-,18+,22? |
| InChIKey | BJHMBQVVHCIAEG-VSOVRNOCSA-N |
| XLogP | 4.07 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|