C28H24N2O4S — CID 101434779
benzyl 3-(4-methylphenyl)sulfonyl-3,12-diazatetracyclo[6.5.1.19,13.04,14]pentadeca-1,4,6,8(14),10-pentaene-12-carboxylate (PubChem CID 101434779) has the molecular formula C28H24N2O4S and a molecular weight of 484.58 g/mol. Its IUPAC name is benzyl 3-(4-methylphenyl)sulfonyl-3,12-diazatetracyclo[6.5.1.19,13.04,14]pentadeca-1,4,6,8(14),10-pentaene-12-carboxylate.
| Compound Name | benzyl 3-(4-methylphenyl)sulfonyl-3,12-diazatetracyclo[6.5.1.19,13.04,14]pentadeca-1,4,6,8(14),10-pentaene-12-carboxylate |
|---|---|
| PubChem CID | 101434779 |
| Molecular Formula | C28H24N2O4S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | benzyl 3-(4-methylphenyl)sulfonyl-3,12-diazatetracyclo[6.5.1.19,13.04,14]pentadeca-1,4,6,8(14),10-pentaene-12-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)n2cc3c4c(cccc42)C2C=CN(C(=O)OCc4ccccc4)C3C2)cc1 |
| InChI | InChI=1S/C28H24N2O4S/c1-19-10-12-22(13-11-19)35(32,33)30-17-24-26-16-21(23-8-5-9-25(30)27(23)24)14-15-29(26)28(31)34-18-20-6-3-2-4-7-20/h2-15,17,21,26H,16,18H2,1H3 |
| InChIKey | RSLILHOFCQUHAP-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |