C20H28O4 — CID 101434818
(2R,4R,8R,9S,13R)-2,8-dihydroxy-5,5,9-trimethyl-14-methylidenetricyclo[11.2.1.04,9]hexadec-1(16)-ene-10,15-dione (PubChem CID 101434818) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (2R,4R,8R,9S,13R)-2,8-dihydroxy-5,5,9-trimethyl-14-methylidenetricyclo[11.2.1.04,9]hexadec-1(16)-ene-10,15-dione.
| Compound Name | (2R,4R,8R,9S,13R)-2,8-dihydroxy-5,5,9-trimethyl-14-methylidenetricyclo[11.2.1.04,9]hexadec-1(16)-ene-10,15-dione |
|---|---|
| PubChem CID | 101434818 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (2R,4R,8R,9S,13R)-2,8-dihydroxy-5,5,9-trimethyl-14-methylidenetricyclo[11.2.1.04,9]hexadec-1(16)-ene-10,15-dione |
| SMILES | C=C1C(=O)C2=C[C@H]1CCC(=O)[C@]1(C)[C@H](O)CCC(C)(C)[C@H]1C[C@H]2O |
| InChI | InChI=1S/C20H28O4/c1-11-12-5-6-16(22)20(4)15(19(2,3)8-7-17(20)23)10-14(21)13(9-12)18(11)24/h9,12,14-15,17,21,23H,1,5-8,10H2,2-4H3/t12-,14-,15-,17-,20-/m1/s1 |
| InChIKey | MZEJPAGUQDRCOG-PYMGOFIGSA-N |
| XLogP | 2.59 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|