About (3R,4S)-4-(1-bromonaphthalen-2-yl)-3,4-dihydroxybutan-2-one
(3R,4S)-4-(1-bromonaphthalen-2-yl)-3,4-dihydroxybutan-2-one (PubChem CID 101434991) has the molecular formula C14H13BrO3
and a molecular weight of 309.16 g/mol. Its IUPAC name is (3R,4S)-4-(1-bromonaphthalen-2-yl)-3,4-dihydroxybutan-2-one.
Molecular Properties
| Compound Name | (3R,4S)-4-(1-bromonaphthalen-2-yl)-3,4-dihydroxybutan-2-one |
| PubChem CID | 101434991 |
| Molecular Formula | C14H13BrO3 |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | (3R,4S)-4-(1-bromonaphthalen-2-yl)-3,4-dihydroxybutan-2-one |
| SMILES | CC(=O)[C@H](O)[C@@H](O)c1ccc2ccccc2c1Br |
| InChI | InChI=1S/C14H13BrO3/c1-8(16)13(17)14(18)11-7-6-9-4-2-3-5-10(9)12(11)15/h2-7,13-14,17-18H,1H3/t13-,14-/m0/s1 |
| InChIKey | DNYHDTPJQRKIAV-KBPBESRZSA-N |
| XLogP | 2.59 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,4S)-4-(1-bromonaphthalen-2-yl)-3,4-dihydroxybutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-4-(1-bromonaphthalen-2-yl)-3,4-dihydroxybutan-2-one?
The IUPAC name of (3R,4S)-4-(1-bromonaphthalen-2-yl)-3,4-dihydroxybutan-2-one (CID 101434991) is (3R,4S)-4-(1-bromonaphthalen-2-yl)-3,4-dihydroxybutan-2-one.
What is the SMILES notation for (3R,4S)-4-(1-bromonaphthalen-2-yl)-3,4-dihydroxybutan-2-one?
The canonical SMILES for (3R,4S)-4-(1-bromonaphthalen-2-yl)-3,4-dihydroxybutan-2-one is CC(=O)[C@H](O)[C@@H](O)c1ccc2ccccc2c1Br.
What is the InChIKey of (3R,4S)-4-(1-bromonaphthalen-2-yl)-3,4-dihydroxybutan-2-one?
The InChIKey is DNYHDTPJQRKIAV-KBPBESRZSA-N. The full InChI is InChI=1S/C14H13BrO3/c1-8(16)13(17)14(18)11-7-6-9-4-2-3-5-10(9)12(11)15/h2-7,13-14,17-18H,1H3/t13-,14-/m0/s1.
What are the key properties of (3R,4S)-4-(1-bromonaphthalen-2-yl)-3,4-dihydroxybutan-2-one?
(3R,4S)-4-(1-bromonaphthalen-2-yl)-3,4-dihydroxybutan-2-one has a molecular weight of 309.16 g/mol, XLogP of 2.59, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-4-(1-bromonaphthalen-2-yl)-3,4-dihydroxybutan-2-one is sourced from PubChem (CID 101434991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).