C29H37N3O5 — CID 101435495
tert-butyl N-[5-[1-benzyl-3-(3,4-dimethoxyphenyl)-6-oxopyridazin-4-yl]pentyl]carbamate (PubChem CID 101435495) has the molecular formula C29H37N3O5 and a molecular weight of 507.63 g/mol. Its IUPAC name is tert-butyl N-[5-[1-benzyl-3-(3,4-dimethoxyphenyl)-6-oxopyridazin-4-yl]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[1-benzyl-3-(3,4-dimethoxyphenyl)-6-oxopyridazin-4-yl]pentyl]carbamate |
|---|---|
| PubChem CID | 101435495 |
| Molecular Formula | C29H37N3O5 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | tert-butyl N-[5-[1-benzyl-3-(3,4-dimethoxyphenyl)-6-oxopyridazin-4-yl]pentyl]carbamate |
| SMILES | COc1ccc(-c2nn(Cc3ccccc3)c(=O)cc2CCCCCNC(=O)OC(C)(C)C)cc1OC |
| InChI | InChI=1S/C29H37N3O5/c1-29(2,3)37-28(34)30-17-11-7-10-14-22-19-26(33)32(20-21-12-8-6-9-13-21)31-27(22)23-15-16-24(35-4)25(18-23)36-5/h6,8-9,12-13,15-16,18-19H,7,10-11,14,17,20H2,1-5H3,(H,30,34) |
| InChIKey | DMXIOZKIQMIULR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|