About 2-methyl-7-nitro-3,3-diphenyl-[1]benzothiolo[3,2-b]pyrrole
2-methyl-7-nitro-3,3-diphenyl-[1]benzothiolo[3,2-b]pyrrole (PubChem CID 101435818) has the molecular formula C23H16N2O2S
and a molecular weight of 384.46 g/mol. Its IUPAC name is 2-methyl-7-nitro-3,3-diphenyl-[1]benzothiolo[3,2-b]pyrrole.
Molecular Properties
| Compound Name | 2-methyl-7-nitro-3,3-diphenyl-[1]benzothiolo[3,2-b]pyrrole |
| PubChem CID | 101435818 |
| Molecular Formula | C23H16N2O2S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 2-methyl-7-nitro-3,3-diphenyl-[1]benzothiolo[3,2-b]pyrrole |
| SMILES | CC1=Nc2c(sc3ccc([N+](=O)[O-])cc23)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H16N2O2S/c1-15-23(16-8-4-2-5-9-16,17-10-6-3-7-11-17)22-21(24-15)19-14-18(25(26)27)12-13-20(19)28-22/h2-14H,1H3 |
| InChIKey | KWNCWBGTELKCBP-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-7-nitro-3,3-diphenyl-[1]benzothiolo[3,2-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-7-nitro-3,3-diphenyl-[1]benzothiolo[3,2-b]pyrrole?
The IUPAC name of 2-methyl-7-nitro-3,3-diphenyl-[1]benzothiolo[3,2-b]pyrrole (CID 101435818) is 2-methyl-7-nitro-3,3-diphenyl-[1]benzothiolo[3,2-b]pyrrole.
What is the SMILES notation for 2-methyl-7-nitro-3,3-diphenyl-[1]benzothiolo[3,2-b]pyrrole?
The canonical SMILES for 2-methyl-7-nitro-3,3-diphenyl-[1]benzothiolo[3,2-b]pyrrole is CC1=Nc2c(sc3ccc([N+](=O)[O-])cc23)C1(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-methyl-7-nitro-3,3-diphenyl-[1]benzothiolo[3,2-b]pyrrole?
The InChIKey is KWNCWBGTELKCBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N2O2S/c1-15-23(16-8-4-2-5-9-16,17-10-6-3-7-11-17)22-21(24-15)19-14-18(25(26)27)12-13-20(19)28-22/h2-14H,1H3.
What are the key properties of 2-methyl-7-nitro-3,3-diphenyl-[1]benzothiolo[3,2-b]pyrrole?
2-methyl-7-nitro-3,3-diphenyl-[1]benzothiolo[3,2-b]pyrrole has a molecular weight of 384.46 g/mol, XLogP of 6.25, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-7-nitro-3,3-diphenyl-[1]benzothiolo[3,2-b]pyrrole is sourced from PubChem (CID 101435818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).