C26H28N2O6 — CID 101435909
benzyl N-[3-(2-hydroxypropoxymethyl)-5-(phenylmethoxycarbonylamino)phenyl]carbamate (PubChem CID 101435909) has the molecular formula C26H28N2O6 and a molecular weight of 464.52 g/mol. Its IUPAC name is benzyl N-[3-(2-hydroxypropoxymethyl)-5-(phenylmethoxycarbonylamino)phenyl]carbamate.
| Compound Name | benzyl N-[3-(2-hydroxypropoxymethyl)-5-(phenylmethoxycarbonylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 101435909 |
| Molecular Formula | C26H28N2O6 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | benzyl N-[3-(2-hydroxypropoxymethyl)-5-(phenylmethoxycarbonylamino)phenyl]carbamate |
| SMILES | CC(O)COCc1cc(NC(=O)OCc2ccccc2)cc(NC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C26H28N2O6/c1-19(29)15-32-16-22-12-23(27-25(30)33-17-20-8-4-2-5-9-20)14-24(13-22)28-26(31)34-18-21-10-6-3-7-11-21/h2-14,19,29H,15-18H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | UZPXEXMFZIZLIJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |