C18H15NO4S — CID 101436004
(3aS,9R,9aS)-9-hydroxy-2-(4-methoxyphenyl)-9,9a-dihydro-3aH-thiochromeno[2,3-c]pyrrole-1,3-dione (PubChem CID 101436004) has the molecular formula C18H15NO4S and a molecular weight of 341.39 g/mol. Its IUPAC name is (3aS,9R,9aS)-9-hydroxy-2-(4-methoxyphenyl)-9,9a-dihydro-3aH-thiochromeno[2,3-c]pyrrole-1,3-dione.
| Compound Name | (3aS,9R,9aS)-9-hydroxy-2-(4-methoxyphenyl)-9,9a-dihydro-3aH-thiochromeno[2,3-c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 101436004 |
| Molecular Formula | C18H15NO4S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | (3aS,9R,9aS)-9-hydroxy-2-(4-methoxyphenyl)-9,9a-dihydro-3aH-thiochromeno[2,3-c]pyrrole-1,3-dione |
| SMILES | COc1ccc(N2C(=O)[C@H]3[C@H](Sc4ccccc4[C@@H]3O)C2=O)cc1 |
| InChI | InChI=1S/C18H15NO4S/c1-23-11-8-6-10(7-9-11)19-17(21)14-15(20)12-4-2-3-5-13(12)24-16(14)18(19)22/h2-9,14-16,20H,1H3/t14-,15+,16+/m1/s1 |
| InChIKey | YWXCULQFZFYORI-PMPSAXMXSA-N |
| XLogP | 2.39 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|