C17H22O6 — CID 101436085
methyl (E,3S)-3-(2,2-dimethyl-4,6-dioxo-5-prop-2-enyl-1,3-dioxan-5-yl)-2-methylidenehex-4-enoate (PubChem CID 101436085) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is methyl (E,3S)-3-(2,2-dimethyl-4,6-dioxo-5-prop-2-enyl-1,3-dioxan-5-yl)-2-methylidenehex-4-enoate.
| Compound Name | methyl (E,3S)-3-(2,2-dimethyl-4,6-dioxo-5-prop-2-enyl-1,3-dioxan-5-yl)-2-methylidenehex-4-enoate |
|---|---|
| PubChem CID | 101436085 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | methyl (E,3S)-3-(2,2-dimethyl-4,6-dioxo-5-prop-2-enyl-1,3-dioxan-5-yl)-2-methylidenehex-4-enoate |
| SMILES | C=CCC1([C@@H](/C=C/C)C(=C)C(=O)OC)C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C17H22O6/c1-7-9-12(11(3)13(18)21-6)17(10-8-2)14(19)22-16(4,5)23-15(17)20/h7-9,12H,2-3,10H2,1,4-6H3/b9-7+/t12-/m0/s1 |
| InChIKey | YUCHQVBBTJUKOL-CRALRDPISA-N |
| XLogP | 2.31 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|